Kobusone | MedChemExpress (MCE)
Kobusone
is a natural compound isolated form Aquilaria sinensis. kobusone can stimulate islet β-cell
replication in vivo, and has the potential to be used in diabetic
study[1][2].
| Trivial name | Kobusone |
| Catalog Number | HY-N3419 |
| Research Area | Metabolic Disease |
| CAS# | 24173-71-5 |
| Purity | ≥98.00% |
| SMILES | C[C@@]12[C@@H](CCC([C@]3([H])[C@@](C(C)(C)C3)([H])CC2)=O)O1 |
| PubChem Chemical Structure ID | 6710676 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kobusone.html |