ZN-A-1041 | MedChemExpress (MCE)
ZN-A-1041 inhibits HER2 in BT474 cell and wt-EGFR in H838 cells, with IC50s of 9.5 nM and 12 μM respectively. ZN-A-1041 can be used for research of cancer and inflammation[1].
| Trivial name | ZN-A-1041 |
| Catalog Number | HY-163428 |
| Research Area | Inflammation/Immunology; Cancer |
| CAS# | 2414056-31-6 |
| Purity | ≥98.0% |
| SMILES | COC1=C(C2=C(N=CN=C2NC3=CC(C)=C(C=C3)OC4=CC5=NC=NN5C=N4)C=C1)O[C@@H]6CCN(CC6(F)F)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zn-a-1041.html |