MBX 102
Arhalofenate is a selective partial agonist of peroxisome proliferator-activated receptor (PPAR)-γ ans is used for the treatment of type 2 diabetes.
| Trivial name | MBX 102; JNJ 39659100 |
| Catalog Number | CSN22075 |
| Alternative Name(s) | MBX 102; JNJ 39659100 |
| Research Area | / |
| Molecular Formula | C19H17ClF3NO4 |
| CAS# | 24136-23-0 |
| Purity | ≥98% |
| SMILES | O=C(OCCNC(C)=O)[C@@H](C1=CC=C(Cl)C=C1)OC2=CC=CC(C(F)(F)F)=C2 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/mbx-102.html |