ZW290 | MedChemExpress (MCE)
ZW290 is a compound to activate brown adipose tissue (BAT) thermogenic function. ZW290 increases the expression of uncoupling Protein 1 (UCP1) protein and inhibits ATP synthesis in BAT[1].
| Trivial name | ZW290 |
| Catalog Number | HY-148973 |
| Research Area | Metabolic Disease |
| CAS# | 2411852-67-8 |
| Purity | ≥98.00% |
| SMILES | O=C1N(C2=CC=C(C=C2)OC)C(N/C1=C\C3=CC(OC)=C(C=C3)OCC(O)=O)=S |
| PubChem Chemical Structure ID | 5433662 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zw290.html |