Lotiglipron | MedChemExpress (MCE)
Lotiglipron (PF-07081532) is an orally active GLP-1R agonist. Lotiglipron reduces glucose and body weight, and can be used for research of Type 2 diabetes mellitus (T2DM)[1].
| Trivial name | Lotiglipron |
| Catalog Number | HY-153865 |
| Alternative Name(s) | PF-07081532 |
| Research Area | Metabolic Disease |
| CAS# | 2401892-75-7 |
| Purity | 99.68% |
| SMILES | C[C@@]1(C2=CC=C(C=N2)Cl)OC3=C(C4CCN(CC4)CC(N(C5=C6)C[C@@H]7CCO7)=NC5=CC=C6C(O)=O)C=CC=C3O1 |
| PubChem Chemical Structure ID | 146609022 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lotiglipron.html |