Lenalidomide 4′-PEG2-azide | MedChemExpress (MCE)
Lenalidomide 4′-PEG2-azide is the Lenalidomide-based Cereblon ligand used in the recruitment of CRBN protein. Lenalidomide 4′-PEG2-azide can be connected to the ligand for protein by a linker to form PROTAC[1].
| Trivial name | Lenalidomide 4'-PEG2-azide |
| Catalog Number | HY-161134 |
| Research Area | Cancer |
| CAS# | 2399455-48-0 |
| Purity | ≥98.00% |
| SMILES | [N-]=[N+]=NCCOCCOCCNC1=CC=CC2=C1CN(C3C(NC(CC3)=O)=O)C2=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lenalidomide-4-peg2-azide.html |