Lenalidomide 4′-PEG1-azide | MedChemExpress (MCE)
Lenalidomide 4′-PEG1-azide (Compound 4g) is a lenalidomide-derived azide. Lenalidomide 4′-PEG1-azide incorporates the Lenalidomide based cereblon ligand and a linker. Lenalidomide 4′-PEG1-azide is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups.[1].
Trivial name | Lenalidomide 4'-PEG1-azide |
Catalog Number | HY-161133 |
Research Area | Cancer |
CAS# | 2399455-45-7 |
Purity | ≥98.00% |
SMILES | [N-]=[N+]=NCCOCCNC1=CC=CC2=C1CN(C3C(NC(CC3)=O)=O)C2=O |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/lenalidomide-4-peg1-azide.html |