Maleic hydrazide-d2 | MedChemExpress (MCE)
Maleic hydrazide-d2 is the deuterium labeled Maleic hydrazide[1]. Maleic hydrazide is extensively used as a systemic plant growth regulator and as a herbicide. Maleic hydrazide acts as an inhibitor of the synthesis of nucleic acids and proteins[2][3].
| Trivial name | Maleic hydrazide-d2 |
| Catalog Number | HY-59354S |
| Research Area | Cancer |
| CAS# | 2398483-97-9 |
| Purity | ≥98.00% |
| SMILES | O=C1C([2H])=C([2H])C(NN1)=O |
| PubChem Chemical Structure ID | 129318118 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/maleic-hydrazide-d2.html |