Nicotinic acid N-oxide
Nicotinic acid N-oxide is a nicotinic acid derivative used to synthesize and characterize peroxo complexes of vanadium(V) and molybdenum (VI) with nicotinic acid and nicotinic acid N-oxide.
Trivial name | 3-Carboxypyridine 1-Oxide |
Catalog Number | CSN11554 |
Alternative Name(s) | 3-Carboxypyridine 1-Oxide |
Research Area | Cardiovascular Disease |
Molecular Formula | C6H5NO3 |
CAS# | 2398-81-4 |
Purity | ≥99% |
SMILES | O=C(C1=C[N+]([O-])=CC=C1)O |
Size | 1g |
Supplier Page | https://www.csnpharm.com/products/nicotinic-acid-n-oxide.html |