Meranzin
Meranzin, a natural product isolated and purified from the peel of Citrus maxima, can induce similar effect to Fructus Aurantii on intestinal motility and it was, at least in part, mediated by stimulation of H1 histamine receptors.
| Trivial name | / |
| Catalog Number | CSN14012 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C15H16O4 |
| CAS# | 23971-42-8 |
| Purity | ≥98% |
| SMILES | O=C1C=CC2=CC=C(OC)C(C[C@@H]3OC3(C)C)=C2O1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/meranzin.html |