β-Muricholic acid | MedChemExpress (MCE)
β-Muricholic acid is a potent and orally active biliary cholesterol-desaturating agent. β-Muricholic acid prevents cholesterol gallstones. β-Muricholic acid inhibits lipid accumulation. β-Muricholic acid has the potential for the research of nonalcoholic fatty liver disease (NAFLD)[1][2].
| Trivial name | β-Muricholic acid |
| Catalog Number | HY-133707 |
| Research Area | Metabolic Disease |
| CAS# | 2393-59-1 |
| Purity | 99.92% |
| SMILES | C[C@H](CCC(O)=O)[C@H]1CC[C@@]2([H])[C@]3([H])[C@@H](O)[C@@H](O)[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C |
| PubChem Chemical Structure ID | 5283853 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/β-muricholic-acid.html |