CHR2797 25mg
CHR-2797 (Tosedostat) is a novel metalloenzyme inhibitor that exerts antiproliferative effects against a range of tumor cell lines in vitro and in vivo and shows selectivity.
| Trivial name | CHR2797 25mg |
| Catalog Number | A10208-25 |
| Alternative Name(s) | alpha-[[(2R)-2-[(1S)-1-Hydroxy-2-(hydroxyamino)-2-oxoethyl]-4-methyl-1-oxopentyl]amino]benzeneacetic acid cyclopentyl ester |
| Molecular Formula | C21H30N2O6 |
| CAS# | 238750-77-1 |
| SMILES | CC(C)C[C@H]([C@@H](C(=O)NO)O)C(=O)N[C@@H](C1=CC=CC=C1)C(=O)OC2CCCC2 |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/chr2797-tosedostat.html |