Ambroxol Hydrochloride
A metabolite of BROMHEXINE that stimulates mucociliary action and clears the air passages in the respiratory tract. It is usually administered as the hydrochloride.
| Catalog Number | API23828924 |
| Alternative Name(s) | ambroxol 18683-91-5 107814-37-9 rac-cis-Ambroxol 36557-04-7 |
| Research Area | Expectorant APIs |
| Molecular Formula | C13H18Br2N2O.HCl |
| CAS# | 23828-92-4 |
| SMILES | C1CC(CCC1NCC2=C(C(=CC(=C2)Br)Br)N)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/ambroxol-hydrochloride-item-11627.html |