Ambroxol HCl
Ambroxol HCl is an inhibitor of neuronal Na+ channels. It inhibits TTX-resistant and sensitive Na+ currents with IC50 of 35.2 μM (tonic)/22.5 μM (phasic block) and 100 μM, respectively.
| Trivial name | / |
| Catalog Number | CSN11757 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C13H19Br2ClN2O |
| CAS# | 23828-92-4 |
| Purity | ≥99% |
| SMILES | O[C@H]1CC[C@H](NCC2=CC(Br)=CC(Br)=C2N)CC1.Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/ambroxol-hcl.html |