μ opioid receptor agonist 3 | MedChemExpress (MCE)
μ opioid receptor agonist 3 (compound 20) is a potent μ opioid receptor (µOR) agonist with an EC50 of 0.87 nM. μ opioid receptor agonist 3 has the potential for pain and neuropsychiatric indications research[1].
| Trivial name | μ opioid receptor agonist 3 |
| Catalog Number | HY-155319 |
| Research Area | Neurological Disease |
| CAS# | 2378397-91-0 |
| Purity | ≥98.00% |
| SMILES | OC1=CC=C(C[C@H](N(C)C)CNC([C@@H]2C[C@]2(C3=CC=CC=C3)C)=O)C=C1 |
| PubChem Chemical Structure ID | 139569022 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/μ-opioid-receptor-agonist-3.html |