CTPS1-IN-2 | MedChemExpress (MCE)
CTPS1-IN-2 (P115) is an inhibitor of Cytidine Triphosphate Synthase 1 (CTPS1) with an IC50 value of ≤ 0.1 μM. CTPS1-IN-2 can be used for research on cancer (such as leukemia and lymphoma), inflammatory skin diseases (such as psoriasis), or multiple sclerosis[1].
| Trivial name | CTPS1-IN-2 |
| Catalog Number | HY-157783 |
| Research Area | Inflammation/Immunology; Cancer |
| CAS# | 2377000-84-3 |
| Purity | ≥98.0% |
| SMILES | O=C(C1(CCOCC1)C2=NC(NS(=O)(C3CC3)=O)=NC=C2)NC4=NC=C(C5=CN=CC(OCC)=N5)C=C4 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ctps1-in-2.html |