MC-1-F2 | MedChemExpress (MCE)
MC-1-F2 is a FOXC2 inhibitor that reduces epithelial-mesenchymal transition (EMT) markers in breast cancer cells, suppresses cancer stem cell (CSC) properties and reduces invasiveness in castration-resistant prostate cancer (CRPC) cells. There is a synergistic effect between MC-1-F2 and Docetaxel, which has the potential to be used in combination to study CRPC[1].
| Trivial name | MC-1-F2 |
| Catalog Number | HY-149894 |
| Research Area | Cancer |
| CAS# | 2376894-10-7 |
| Purity | ≥98.00% |
| SMILES | N=C(NCCCCNC1=NC(NC2=CC=C(C=C2)OC3=CC=CC=C3)=NC(N4CCN(CC4)C5=NC(NC6=CC=C(N7CCOCC7)C=C6)=NC(N)=N5)=N1)N |
| PubChem Chemical Structure ID | 139519325 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mc-1-f2.html |