Zalunfiban acetate | MedChemExpress (MCE)
Zalunfiban (RUC-4) acetate is a potent, selective platelet αIIbβ3antagonist (IC50=45 nM). Zalunfiban acetate can be used for the research of myocardial infarction (MI)[1].
| Trivial name | Zalunfiban acetate |
| Catalog Number | HY-119350C |
| Alternative Name(s) | RUC-4 acetate |
| Research Area | Cardiovascular Disease |
| CAS# | 2376629-15-9 |
| Purity | ≥98.00% |
| SMILES | O=C(NC1=CC(C(S2)=NN(C2=NC(N3CCNCC3)=C4)C4=O)=CN=C1)CN.OC(C)=O |
| PubChem Chemical Structure ID | 156028133 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zalunfiban-acetate.html |