Alsterpaullone
Alsterpaullone is a potent CDK1 and 2 inhibitor with IC50s of 0.035 and 0.08 μM, respectively. It also inhibits GSK-3β and Lck with IC50s of 0.11 and 0.47 μM, respectively.
| Trivial name | / |
| Catalog Number | CSN22673 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C16H11N3O3 |
| CAS# | 237430-03-4 |
| Purity | ≥98% |
| SMILES | O=C1CC2=C(C3=CC=CC=C3N1)NC4=C2C=C([N+]([O-])=O)C=C4 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/alsterpaullone.html |