Tubulin polymerization-IN-60 | MedChemExpress (MCE)
Tubulin polymerization-IN-60 (BF3) is a tubulin polymerization inhibitor with anticancer activity. Tubulin polymerization-IN-60 (BF3) belongs to the colchicine binding site inhibitors (CBSIs) and disturbs cell cycle progression leading to G2/M arrest and apoptosis[1].
| Trivial name | Tubulin polymerization-IN-60 |
| Catalog Number | HY-163356 |
| Research Area | Cancer |
| CAS# | 2361303-91-3 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=C(C2=CC=CC=C2)OC3=C1C=CC=C3OC)C4=CC(OC)=C(C(OC)=C4)OC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/tubulin-polymerization-in-60.html |