Clotrimazole
Antifungal skin medication for the treatment of deep and superficial fungal diseases caused by sensitive bacteria, such as cryptococcal meningitis, Candida pneumonia, enteritis, histoplasmosis, body moss, hand and foot moss.
| Catalog Number | API23593751 |
| Alternative Name(s) | Lotrimin Canesten Mycelex |
| Research Area | Antibacterial APIs |
| Molecular Formula | C22H17ClN2 |
| CAS# | 23593-75-1 |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3Cl)N4C=CN=C4 |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/clotrimazole-item-11558.html |