Daunorubicin HCl
Daunorubicin HCl inhibits both DNA and RNA synthesis and inhibits DNA synthesis with Ki of 0.02 μM in a cell-free assay. Daunorubicin is a topoisomerase II inhibitor that induces apoptosis.
| Trivial name | Rubidomycin HCl, RP 13057 HCl |
| Catalog Number | S3035 |
| Molecular Formula | C27H29NO10 . HCl |
| CAS# | 23541-50-6 |
| Inchi | InChI=1S/C27H29NO10.ClH/c1-10-22(30)14(28)7-17(37-10)38-16-9-27(35,11(2)29)8-13-19(16)26(34)21-20(24(13)32)23(31)12-5-4-6-15(36-3)18(12)25(21)33;/h4-6,10,14,16-17,22,30,32,34-35H,7-9,28H2,1-3H3;1H/t10 -,14-,16-,17-,22+,27-;/m0./s1 |
| Inchi Key | GUGHGUXZJWAIAS-QQYBVWGSSA-N |
| SMILES | CC1C(C(CC(O1)OC2CC(CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)C)O)N)O.Cl |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/daunorubicin-hcl-daunomycin-hcl.html |
| Additional Information | https://file.selleck.cn/downloads/struct/daunomycin-hcl-chemical-structure-s3035.gif |