Cerubidine 10mg
Cerubidine (Daunorubicin HCl, Rubidomycin HCl) interacts with DNA by intercalation and inhibition of macromolecular biosynthesis. This inhibits the progression of the enzyme topoisomerase II, which relaxes supercoils in DNA for transcription. It stabilizes the topoisomerase II complex after it has broken the DNA chain for replication, preventing the DNA double helix from being resealed and thereby stopping the process of replication.
| Trivial name | Cerubidine 10mg |
| Catalog Number | A10194-10 |
| Alternative Name(s) | (8S,10S)-8-acetyl-10-[(2S,4S,5S,6S)- 4-amino-5-hydroxy-6-methyl-oxan- 2-yl]oxy-6,8,11-trihydroxy-1-methoxy- 9,10-dihydro-7H-tetracene-5,12-dione hydrochloride |
| Molecular Formula | C27H29NO10.HCl |
| CAS# | 23541-50-6 |
| SMILES | C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C(C4=C(C(=C23)O)C(=O)C5=C(C4=O)C=CC=C5OC)O)(C(=O)C)O)N)O.Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/cerubidine-daunorubicin-hcl-rubidomycin-hcl.html |
