Hoechst 33258 analog 5 50mg
Hoechst 33258 analog 5 is a analog of Hoechst stains, which are part of a family of blue fluorescent dyes used to stain DNA.
Trivial name | Hoechst 33258 analog 5 50mg |
Catalog Number | A15110-50 |
Alternative Name(s) | 6-(4-methylpiperazin-1-yl)-2-(2-naphthalen-2-yl-3H-benzimidazol-5-yl)-1H-benzimidazole |
Molecular Formula | C29H26N6 |
CAS# | 23491-55-6 |
SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)C6=CC7=CC=CC=C7C=C6 |
Size | 50mg |
Supplier Page | http://www.adooq.com/hoechst-33258-analog-5.html |