Nefopam Hydrochloride
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-10072 |
| Alternative Name(s) | 3,4,5,6-Tetrahydro-5-methyl-1-phenyl-1H-2,5-benzox Hy; Ajan; Fenazoxine; Fenazoxine hydrochloride; R 738; |
| Research Area | A cyclized analog of orphenadrine and diphenhydramine; representative of a new class of centrally acting skeletal muscle relaxants, the benzoxazocines. Analgesic; antidepressant. |
| Molecular Formula | C17H20ClNO |
| CAS# | 23327-57-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CN1CC(C=CC=C2)=C2C(C3=CC=CC=C3)OCC1.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10072.html |
| Additional Information | NULL |