Probucol 10mM * 1mL in DMSO
Probucol lowers the level of cholesterol in the bloodstream by increasing the rate of LDL catabolism. Additionally, probucol may inhibit cholesterol synthesis and delay cholesterol absorption.
| Trivial name | Probucol 10mM * 1mL in DMSO |
| Catalog Number | A11751-10mM-D |
| Alternative Name(s) | 4,4'-[propane-2,2-diylbis(thio)]bis(2,6-di-tert-butylphenol) |
| Molecular Formula | C31H48O2S2 |
| CAS# | 23288-49-5 |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)SC(C)(C)SC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/probucol.html |