Sulphachlorpyridazine Sodium
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-00319 |
| Alternative Name(s) | sodium 4-amino-N-(6-chloropyridazin-3-yl)benzenesulfonimidate |
| Research Area | Sulfachloropyridazine is a sulfonamide antibiotic that is used to study kinetics, reaction pathways and toxicity evolution. Sulfachloropyridazine has been used to treat acute urinary tract infections in pediatric patients |
| Molecular Formula | C10H8ClN4O2S |
| CAS# | 23282-55-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[S](NC1=CC=C(Cl)N=N1)(C2=CC=C(N)C=C2)=O.[Na+] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00319.html |
| Additional Information | NULL |