Riddelline
API Standards
| Trivial name | NULL |
| Catalog Number | CS-T-61150 |
| Alternative Name(s) | (6S,9a1R,14aR,Z)-3-ethylidene-6-hydroxy-6-(hydroxymethyl)-5-methylene-3,4,5,6,11,13,14,14a-octahydro-[1,6]dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7(9H,9a1H)-dione |
| Research Area | Riddelline is a pyrrolizidine alkaloid that is found in Senecio riddellii, an herbal plant that grows in sandy areas. Riddelline has genotoxic and mutagenic effects in rats, and is potentially harmful to humans. |
| Molecular Formula | C18H23NO6 |
| CAS# | 23246-96-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(/C(CC([C@]1(O)CO)=C)=CC)O[C@@]2([H])[C@@]3([H])C(COC1=O)=CCN3CC2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST61150.html |
| Additional Information | NULL |