Laccaic acid C | MedChemExpress (MCE)
Laccaic acid C is an potent inhibitor of RNase H with an IC50 of 8.1 μM. Laccaic acid C also inhibits viral proliferation in cell [1].
| Trivial name | Laccaic acid C |
| Catalog Number | HY-N12387 |
| Research Area | Infection |
| CAS# | 23241-56-7 |
| Purity | ≥98.00% |
| SMILES | OC(C1=C(C(O)=O)C(O)=CC(C(C2=C3C(O)=C(C4=C(O)C=CC(CC(N)C(O)=O)=C4)C(O)=C2O)=O)=C1C3=O)=O |
| PubChem Chemical Structure ID | 9828689 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/laccaic-acid-c.html |