Benzocaine HCl
Benzocaine HCl is a surface anesthetic that acts by preventing transmission of impulses along nerve fibers and at nerve endings.
| Trivial name | Ethyl 4-Aminobenzoate HCl |
| Catalog Number | CSN18717 |
| Alternative Name(s) | Ethyl 4-Aminobenzoate HCl |
| Research Area | Neurological Disease |
| Molecular Formula | C9H12ClNO2 |
| CAS# | 23239-88-5 |
| Purity | ≥98% |
| SMILES | O=C(OCC)C1=CC=C(N)C=C1.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/benzocaine-hcl.html |