Levonorgestrel EP Impurity R
Impurity in commercial preparations of Levonorgestrel. Max LMG is a progestin derived steroid and not a 17-alpha alkylated steroid. Max LMG is structurally related to RU-486 and acts as an antiprogesterone, decreasing estrogen-like effects.
| Catalog Number | CS-O-32358 |
| Alternative Name(s) | Levonorgestrel EP Impurity R;Methoxygonadiene;Methoxygonadiene;13-Ethyl-3-methoxy-gona-2,5(10)-diene-17-one; Tren; Trena; Methoxygonadiene; Levonorgestrel Impurity R (EP) |
| Molecular Formula | C20H28O2 |
| CAS# | 2322-77-2 |
| Purity | >98% |
| SMILES | CC[C@@]1(C2=O)[C@](CC2)([H])[C@@](CCC3=C4CC=C(OC)C3)([H])[C@]4([H])CC1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO32358.html |