T3SS-IN-4 | MedChemExpress (MCE)
T3SS-IN-4 (Compound Z-8) is a T3SS inhibitor that can inhibit the expression of Xanthomonas oryzae pv oryzae (Xoo) T3SS-related genes without affecting bacterial growth. T3SS-IN-4 can effectively reduce the hypersensitive response (HR) induced by Xoo in tobacco and lower the pathogenicity of Xoo in rice[1].
| Trivial name | T3SS-IN-4 |
| Catalog Number | HY-162376 |
| Research Area | Infection |
| CAS# | 2316760-41-3 |
| Purity | ≥98.0% |
| SMILES | CN1C2=C(F)C=CC=C2C=C3C1=NC4=C3C=CC=C4 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/t3ss-in-4.html |