3,4-Dimethoxycinnamic acid
3,4-Dimethoxycinnamic acid, previously identified in plasma after coffee consumption, was rapidly absorbed in the free form most likely by passive diffusion in the upper gastrointestinal tract.
| Trivial name | O-Methylferulic acid |
| Catalog Number | CSN24976 |
| Alternative Name(s) | O-Methylferulic acid |
| Research Area | / |
| Molecular Formula | C11H12O4 |
| CAS# | 2316-26-9 |
| Purity | ≥99% |
| SMILES | COC1=C(OC)C=C(C=CC(O)=O)C=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/3,4-dimethoxycinnamic-acid.html |