Nicotinamide Riboside Chloride
Nicotinamide riboside chloride (abbreviated NR-Cl) is a precursor of an important coenzyme, also known as vitamin B3. This coenzyme is nicotinamide adenine dinucleotide (NAD+, also known as coenzyme I ), a coenzyme that transmits protons and is present in many metabolic reactions of cells. Involved in the breakdown of compounds such as proteins, carbohydrates, and fats, the human body cannot live without this coenzyme. As cells age or become diseased, their amount decreases. Therefore, supplementation with nicotinamide ribose increases the amount of this coenzyme (NAD+ ) and improves the basic metabolic activity of cells, thus significantly improving cellular vitality and all aspects of human physiology.
Nicotinamide riboside chloride is a crystalline form of nicotinamide riboside (NR) chloride called NIAGEN that is generally considered safe (GRAS) for use in food and dietary supplements. Chemical book Nicotinamide Riboside is a source of vitamin B3 (niacin), which enhances oxidative metabolism and prevents metabolic abnormalities caused by a high-fat diet.
Catalog Number | ABA-098 |
Alternative Name(s) | NRC; NR-CL; Nicotinamide Riboside.Cl |
CAS# | 23111-00-4 |
SMILES | NC(C1=C[N+]([C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)=CC=C1)=O.[Cl-] |
Size | Inquiry |
Supplier Page | https://www.agingclocks.com/nicotinamide-riboside-chloride-item-1967.html |