FLS-359 | MedChemExpress (MCE)
FLS-359 is a selective, orally active allosteric modulator for sirtuin 2, with the IC50 of 3 μM. FLS-359 exhibits antiviral activity against RNA and DNA virus, through inhibition of DNA/RNA replication[1].
| Trivial name | FLS-359 |
| Catalog Number | HY-163532 |
| CAS# | 2309398-79-4 |
| Purity | ≥98.0% |
| SMILES | CC1=CN(C(C)=N1)C2=CC=C3CCN(CC3=C2)C4=NC=C(S4)CC5=CC=C(C=C5)N6C=CC=N6 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/fls-359.html |