Methyl Ferulate
Methyl Ferulate is a naturally-occurring phenolic with antioxidant activities and inhibits the release of pro-inflammatory cytokines, blocks the expression of COX-2, and reduces nitric oxide generation from LPS-stimulated macrophages.
| Trivial name | Methyl 4'-hydroxy-3'-methoxycinnamate;Ferulic Acid methyl ester |
| Catalog Number | CSN23347 |
| Alternative Name(s) | Methyl 4'-hydroxy-3'-methoxycinnamate;Ferulic Acid methyl ester |
| Research Area | / |
| Molecular Formula | C11H12O4 |
| CAS# | 2309-07-1 |
| Purity | ≥99% |
| SMILES | O=C(OC)/C=C/C1=CC=C(O)C(OC)=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/methyl-ferulate.html |