LDC195943 (IMT1)
LDC195943 (IMT1) is a specific and noncompetitive inhibitor of human mitochondrial RNA polymerase (POLRMT). IMT1 causes a conformational change of POLRMT, which blocks substrate binding and transcription in a dose-dependent way in vitro. IMT1 reduces deoxynucleoside triphosphate levels and citric acid cycle intermediates, resulting in a marked depletion of cellular amino acid levels. IMT1 has the potential for mitochondrial transcription disorders related diseases.
| Trivial name | IMT1 |
| Catalog Number | E0443 |
| Molecular Formula | C33H38N8O4S |
| CAS# | 2304621-31-4 |
| SMILES | COC1=C(NC(=O)NC2=NC3=C(S2)C=C(NC4=NC=NC5=CC(=C(OC)C=C45)OCCCN6CCN(C)CC6)C=C3)C=C(C)C=C1 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/ldc195943-imt1.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0443-LDC195943-IMT1-chemical-structure.png |
