GW 9662 10mM * 1mL in DMSO
GW 9662 is a selective PPAR?? antagonist (IC50 values are 3.3, 32 and 2000 nM for PPAR??, PPAR?? and PPAR?? respectively).
| Trivial name | GW 9662 10mM * 1mL in DMSO |
| Catalog Number | A11984-10mM-D |
| Alternative Name(s) | 2-Chloro-5-nitro-N-phenylbenzamide |
| Molecular Formula | C13H9N2O3Cl |
| CAS# | 22978-25-2 |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=C(C=CC(=C2)[N+](=O)[O-])Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/gw-9662.html |
