Ginkgolic Acid
Ginkgolic acid is a natural product isolated and purified from the leaves of Ginkgo biloba L.with suspected cytotoxic, allergenic, mutagenic and carcinogenic properties.
| Trivial name | Ginkgolic Acid(15:1); Ginkgolic Acid I; Romanicardic Acid |
| Catalog Number | CSN11097 |
| Alternative Name(s) | Ginkgolic Acid(15:1); Ginkgolic Acid I; Romanicardic Acid |
| Research Area | Cancer |
| Molecular Formula | C22H34O3 |
| CAS# | 22910-60-7 |
| Purity | ≥98% |
| SMILES | O=C(O)C1=C(CCCCCCC/C=C\CCCCCC)C=CC=C1O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/ginkgolic-acid.html |