Silibinin
Silibinin is an antioxidant which shows inhibition of p-glycoprotein-mediated cellular efflux and obvious stability of liver cell membrane. Silibinin can be extracted from the herb of Silybum marianum (L.) Gaertn.
| Trivial name | Silibinin A; Silymarin I; Silybin |
| Catalog Number | CSN16195 |
| Alternative Name(s) | Silibinin A; Silymarin I; Silybin |
| Research Area | / |
| Molecular Formula | C25H22O10 |
| CAS# | 22888-70-6 |
| Purity | ≥98% |
| SMILES | O=C1[C@H](O)[C@@H](C2=CC=C(O[C@H](CO)[C@@H](C3=CC=C(O)C(OC)=C3)O4)C4=C2)OC5=CC(O)=CC(O)=C15 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/silibinin.html |