Aspartame 10mM * 1mL in DMSO
Aspartame is a methyl ester of the dipeptide of the natural amino acids L-aspartic acid and L-phenylalanine. Under strongly acidic or alkaline conditions, aspartame may generate methanol by hydrolysis.
| Trivial name | Aspartame 10mM * 1mL in DMSO |
| Catalog Number | A11698-10mM-D |
| Alternative Name(s) | N-(L-??-Aspartyl)-L-phenylalanine |
| Molecular Formula | C14H18N2O5 |
| CAS# | 22839-47-0 |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@H](CC(=O)O)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/aspartame.html |
