Miconazole nitrate (Standard) | MedChemExpress (MCE)
Miconazole (nitrate) (Standard) is the analytical standard of Miconazole (nitrate). This product is intended for research and analytical applications. Miconazole nitrate (R18134 nitrate) is an imidazole antifungal agent. Miconazole nitrate also has antibacterial effects[2].
| Trivial name | Miconazole nitrate (Standard) |
| Catalog Number | HY-B0454AR |
| Alternative Name(s) | R18134 nitrate (Standard) |
| Research Area | Infection |
| CAS# | 22832-87-7 |
| Purity | ≥98.0% |
| SMILES | [O-][N+](O)=O.ClC1=C(C=CC(Cl)=C1)C(OCC(C=CC(Cl)=C2)=C2Cl)CN3C=CN=C3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/miconazole-nitrate-standard.html |