(±)-HIP-B
(±)-HIP-B is a potent and non-competitive excitatory amino acid transporter (EAAT) blocker. (±)-HIP-B displays no affinity for NMDA and metabotropic glutamate receptors, and weak affinity for AMPA and kainate receptors (IC50 = 35 and 45 μM, respectively). (±)-HIP-B inhibits glutamate-induced [3H]D-aspartate release (IC50 = 1.2 μM) rather than [3H]L-glutamate uptake (IC50 = 16.9 μM).
| Catalog Number | 227619-65-0 |
| Alternative Name(s) | (±)-3-Hydroxy-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d]isoxazole-6-carboxylic acid |
| Molecular Formula | C6H8N2O4 |
| CAS# | 227619-65-0 |
| Purity | ≥98% |
| Inchi | InChI=1S/C6H8N2O4/c9-5-2-1-7-3(6(10)11)4(2)12-8-5/h2-4,7H,1H2,(H,8,9)(H,10,11)/t2-,3-,4-/m0/s1 |
| Inchi Key | IOOKKDXVJPSSSC-HZLVTQRSSA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/hip-b-cas-227619-65-0-item-103043.html |
