(±)-HIP-A | MedChemExpress (MCE)
(±)-HIP-A is a non-competitive excitatory amino acid transporter (EAAT) blocker that effectively blocks Glu uptake (IC50=17-18 μM). (±)-HIP-A is also a lead compound against ischemia-induced neuronal degeneration. (±)-HIP-A can be used in the study of neurological diseases[1].
| Trivial name | (±)-HIP-A |
| Catalog Number | HY-107525 |
| Research Area | Neurological Disease |
| CAS# | 227619-64-9 |
| Purity | ≥98.00% |
| SMILES | OC([C@@H]1[C@]2([H])[C@](ONC2=O)([H])CN1)=O |
| PubChem Chemical Structure ID | 15432001 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/racemic-hip-a.html |