Iothalamic Acid
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-29567 |
| Alternative Name(s) | 3-[(Z)-(1-hydroxyethylidene)amino]-2,4,6-triiodo-5- [(Z)-methyl-C-hydroxycarbonimidoyl]benzoic acid |
| Research Area | Iothalamic Acid is used as a contrast medium in diagnostic radiology. Iothalamic Acid displayed the same level of nephrotoxicity against rat and human renal epithelial cells as conventional ionic contrast medioum. |
| Molecular Formula | C11H9I3N2O4 |
| CAS# | 2276-90-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C(I)=C(NC(C)=O)C(I)=C1C(O)=O)=C1I)NC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST29567.html |
| Additional Information | NULL |