MDL-811 | MedChemExpress (MCE)
MDL-811, an allosteric SIRT6 activator, significantly activates SIRT6 histone H3 deacetylation (H3K9Ac, H3K18Ac, and H3K56Ac). MDL-811 could be used in the study of colorectal cancer[1].
| Trivial name | MDL-811 |
| Catalog Number | HY-156757 |
| Research Area | Cancer |
| CAS# | 2275619-98-0 |
| Purity | ≥98.00% |
| SMILES | CC(C=C(C(Br)=C1)F)=C1NS(=O)(C2=C(C=C(C=C2)NS(=O)(C3=CC(Cl)=CC(Cl)=C3)=O)CN4[C@@H](COCC4)C)=O |
| PubChem Chemical Structure ID | 169450636 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mdl-811.html |