Fosamprenavir Calcium Salt 10mg
Fosamprenavir Calcium Salt is a phosphate ester prodrug of the antiretroviral protease inhibitor amprenavir, with improved solubility over the parent molecule and a potential for reduced pill burden on current dosing regimens; GW433908G is the calcium salt of the prodrug.
| Trivial name | Fosamprenavir Calcium Salt 10mg |
| Catalog Number | A15089-10 |
| Alternative Name(s) | calcium;[(2R,3S)-1-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-[[(3S)-oxolan-3-yl]oxycarbonylamino]-4-phenylbutan-2-yl] phosphate |
| Molecular Formula | C25H34CaN3O9PS |
| CAS# | 226700-81-8 |
| SMILES | CC(C)CN(CC(C(CC1=CC=CC=C1)NC(=O)OC2CCOC2)OP(=O)([O-])[O-])S(=O)(=O)C3=CC=C(C=C3)N.[Ca+2] |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/fosamprenavir-calcium-salt.html |
