04:1 Coenzyme A trisodium | MedChemExpress (MCE)
04:1 Coenzyme A is a biochemical reagent that is a specific form of coenzyme A (CoA), “04:1” usually indicates that the acyl chain of the CoA contains four carbon atoms and one double bond. 04:1 Coenzyme A can be used to study specific biochemical reactions or pathways[1].
| Trivial name | 04:1 Coenzyme A trisodium |
| Catalog Number | HY-E70263 |
| Research Area | Metabolic Disease |
| CAS# | 2260670-60-6 |
| Purity | ≥98.0% |
| SMILES | O[C@@H]1[C@H](OP(O)(O[Na])=O)[C@@H](COP(OP(OCC(C)([C@H](C(NCCC(NCCSC(/C=C/C)=O)=O)=O)O)C)(O[Na])=O)(O[Na])=O)O[C@H]1N2C3=NC=NC(N)=C3N=C2 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/04-1-coenzyme-a-trisodium.html |