Zharp1-211 | MedChemExpress (MCE)
Zharp1-211 is a potent inhibitor of RIPK1 kinase. Zharp1-211 significantly reduces the expression of JAK/STAT1-mediated chemokines and MHC class II molecules in intestinal epithelial cells[1].
| Trivial name | Zharp1-211 |
| Catalog Number | HY-161060 |
| Research Area | Inflammation/Immunology |
| CAS# | 2258671-41-7 |
| Purity | ≥98.00% |
| SMILES | O=C(OC1CCOCC1)N2C3=CC(C(C=C4)=CN5C4=NC(NC(C6CC6)=O)=C5)=CN=C3CC2 |
| PubChem Chemical Structure ID | 153244178 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zharp1-211.html |