OPN expression inhibitor 1
OPN Expression Inhibitor 1 (Compound 11) is a DHA ether derivative containing a 1,2,3-triazole ring that effectively inhibits osteopontin (OPN) expression. It exhibits significant potential as an anticancer agent by specifically targeting OPN, a key factor in breast cancer progression and metastasis.
| Catalog Number | E4781 |
| Molecular Formula | C21H20N4O3 |
| CAS# | 2257492-95-6 |
| Inchi | InChI=1S/C21H20N4O3/c22-18-5-1-2-6-19(18)25-20(26)17-9-7-15(8-10-17)13-24-21(27)28-14-16-4-3-11-23-12-16/h1-12H,13-14,22H2,(H,24,27)(H,25,26) |
| Inchi Key | INVTYAOGFAGBOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NC(=O)C2=CC=C(C=C2)CNC(=O)OCC3=CN=CC=C3 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/opn-expression-inhibitor-1.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4781-OPN-expression-inhibitor-1-chemical-structure.png |
